About [5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate
[5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate (PubChem CID 86673308) has the molecular formula C14H17BrO4
and a molecular weight of 329.19 g/mol. Its IUPAC name is [5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate.
Analyze [5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate?
The IUPAC name of [5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate (CID 86673308) is [5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate.
What is the SMILES notation for [5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate?
The canonical SMILES for [5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate is CC(=O)OCc1cc(COC(C)=O)c(C)c(Br)c1C.
What is the InChIKey of [5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate?
The InChIKey is HXKCBRBJQYEYNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrO4/c1-8-12(6-18-10(3)16)5-13(7-19-11(4)17)9(2)14(8)15/h5H,6-7H2,1-4H3.
What are the key properties of [5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate?
[5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate has a molecular weight of 329.19 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(acetyloxymethyl)-3-bromo-2,4-dimethylphenyl]methyl acetate is sourced from PubChem (CID 86673308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).