C17H12F3N5O — CID 86673358
1-methyl-6-[4-(3-oxopropyl)-3-(trifluoromethyl)phenyl]triazolo[4,5-c]pyridine-4-carbonitrile (PubChem CID 86673358) has the molecular formula C17H12F3N5O and a molecular weight of 359.31 g/mol. Its IUPAC name is 1-methyl-6-[4-(3-oxopropyl)-3-(trifluoromethyl)phenyl]triazolo[4,5-c]pyridine-4-carbonitrile.
| Compound Name | 1-methyl-6-[4-(3-oxopropyl)-3-(trifluoromethyl)phenyl]triazolo[4,5-c]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 86673358 |
| Molecular Formula | C17H12F3N5O |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-methyl-6-[4-(3-oxopropyl)-3-(trifluoromethyl)phenyl]triazolo[4,5-c]pyridine-4-carbonitrile |
| SMILES | Cn1nnc2c(C#N)nc(-c3ccc(CCC=O)c(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C17H12F3N5O/c1-25-15-8-13(22-14(9-21)16(15)23-24-25)11-5-4-10(3-2-6-26)12(7-11)17(18,19)20/h4-8H,2-3H2,1H3 |
| InChIKey | XREFSEUSVKVCFU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|