C14H15ClIN3O3 — CID 86678158
ethyl 6-chloro-3-iodo-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 86678158) has the molecular formula C14H15ClIN3O3 and a molecular weight of 435.65 g/mol. Its IUPAC name is ethyl 6-chloro-3-iodo-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | ethyl 6-chloro-3-iodo-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 86678158 |
| Molecular Formula | C14H15ClIN3O3 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 434.98 |
| IUPAC Name | ethyl 6-chloro-3-iodo-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(Cl)nc2c1c(I)nn2C1CCCCO1 |
| InChI | InChI=1S/C14H15ClIN3O3/c1-2-21-14(20)8-7-9(15)17-13-11(8)12(16)18-19(13)10-5-3-4-6-22-10/h7,10H,2-6H2,1H3 |
| InChIKey | MXAUVHHKZWIBGS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|