C23H30ClN5O4 — CID 86678165
tert-butyl 4-[6-chloro-3-ethenyl-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carbonyl]piperazine-1-carboxylate (PubChem CID 86678165) has the molecular formula C23H30ClN5O4 and a molecular weight of 475.98 g/mol. Its IUPAC name is tert-butyl 4-[6-chloro-3-ethenyl-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carbonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-chloro-3-ethenyl-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86678165 |
| Molecular Formula | C23H30ClN5O4 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | tert-butyl 4-[6-chloro-3-ethenyl-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine-4-carbonyl]piperazine-1-carboxylate |
| SMILES | C=Cc1nn(C2CCCCO2)c2nc(Cl)cc(C(=O)N3CCN(C(=O)OC(C)(C)C)CC3)c12 |
| InChI | InChI=1S/C23H30ClN5O4/c1-5-16-19-15(14-17(24)25-20(19)29(26-16)18-8-6-7-13-32-18)21(30)27-9-11-28(12-10-27)22(31)33-23(2,3)4/h5,14,18H,1,6-13H2,2-4H3 |
| InChIKey | GRIZERMGTLQJFY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 89.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|