C25H35ClN6O2Si — CID 86684149
6-chloro-N-[5-[4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-4-amine (PubChem CID 86684149) has the molecular formula C25H35ClN6O2Si and a molecular weight of 515.13 g/mol. Its IUPAC name is 6-chloro-N-[5-[4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-4-amine.
| Compound Name | 6-chloro-N-[5-[4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-4-amine |
|---|---|
| PubChem CID | 86684149 |
| Molecular Formula | C25H35ClN6O2Si |
| Molecular Weight | 515.13 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 6-chloro-N-[5-[4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-4-amine |
| SMILES | C[Si](C)(C)CCOCn1cnc2c(Nc3ccc(N4CCN(C5COC5)CC4)cn3)cc(Cl)cc21 |
| InChI | InChI=1S/C25H35ClN6O2Si/c1-35(2,3)11-10-33-18-32-17-28-25-22(12-19(26)13-23(25)32)29-24-5-4-20(14-27-24)30-6-8-31(9-7-30)21-15-34-16-21/h4-5,12-14,17,21H,6-11,15-16,18H2,1-3H3,(H,27,29) |
| InChIKey | BQSWTVPIEJXROU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.13 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|