C10H9F2N5 — CID 86684702
benzotriazol-1-yl-(3,3-difluoroazetidin-1-yl)methanimine (PubChem CID 86684702) has the molecular formula C10H9F2N5 and a molecular weight of 237.21 g/mol. Its IUPAC name is benzotriazol-1-yl-(3,3-difluoroazetidin-1-yl)methanimine.
| Compound Name | benzotriazol-1-yl-(3,3-difluoroazetidin-1-yl)methanimine |
|---|---|
| PubChem CID | 86684702 |
| Molecular Formula | C10H9F2N5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | benzotriazol-1-yl-(3,3-difluoroazetidin-1-yl)methanimine |
| SMILES | [H]/N=C(\N1CC(F)(F)C1)n1nnc2ccccc21 |
| InChI | InChI=1S/C10H9F2N5/c11-10(12)5-16(6-10)9(13)17-8-4-2-1-3-7(8)14-15-17/h1-4,13H,5-6H2/b13-9+ |
| InChIKey | QFDJACQIIOWLGC-UKTHLTGXSA-N |
| XLogP | 1.17 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|