C12H4F11N3 — CID 15321653
1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]benzotriazole (PubChem CID 15321653) has the molecular formula C12H4F11N3 and a molecular weight of 399.16 g/mol. Its IUPAC name is 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]benzotriazole.
| Compound Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]benzotriazole |
|---|---|
| PubChem CID | 15321653 |
| Molecular Formula | C12H4F11N3 |
| Molecular Weight | 399.16 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]benzotriazole |
| SMILES | FC(F)(F)C(=C(n1nnc2ccccc21)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H4F11N3/c13-9(14,12(21,22)23)8(7(10(15,16)17)11(18,19)20)26-6-4-2-1-3-5(6)24-25-26/h1-4H |
| InChIKey | JEUVMCLRBPAXNE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.16 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|