C14H6F11N3S — CID 2830734
N-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]benzimidazole-1-carbothioamide (PubChem CID 2830734) has the molecular formula C14H6F11N3S and a molecular weight of 457.27 g/mol. Its IUPAC name is N-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]benzimidazole-1-carbothioamide.
| Compound Name | N-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]benzimidazole-1-carbothioamide |
|---|---|
| PubChem CID | 2830734 |
| Molecular Formula | C14H6F11N3S |
| Molecular Weight | 457.27 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | N-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]benzimidazole-1-carbothioamide |
| SMILES | FC(F)(F)C(=C(NC(=S)n1cnc2ccccc21)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H6F11N3S/c15-11(16,14(23,24)25)9(8(12(17,18)19)13(20,21)22)27-10(29)28-5-26-6-3-1-2-4-7(6)28/h1-5H,(H,27,29) |
| InChIKey | CWSVYBBCCUFGIZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.27 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|