C11H5F11N2 — CID 101033012
N-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyridin-2-amine (PubChem CID 101033012) has the molecular formula C11H5F11N2 and a molecular weight of 374.15 g/mol. Its IUPAC name is N-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyridin-2-amine.
| Compound Name | N-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 101033012 |
| Molecular Formula | C11H5F11N2 |
| Molecular Weight | 374.15 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | N-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyridin-2-amine |
| SMILES | FC(F)(F)C(=C(Nc1ccccn1)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H5F11N2/c12-8(13,11(20,21)22)7(24-5-3-1-2-4-23-5)6(9(14,15)16)10(17,18)19/h1-4H,(H,23,24) |
| InChIKey | NWMMPDSCNDDCHC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.15 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|