C12H6F6N2O3 — CID 164747509
5-(benzimidazol-1-yl)-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid (PubChem CID 164747509) has the molecular formula C12H6F6N2O3 and a molecular weight of 340.18 g/mol. Its IUPAC name is 5-(benzimidazol-1-yl)-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid.
| Compound Name | 5-(benzimidazol-1-yl)-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid |
|---|---|
| PubChem CID | 164747509 |
| Molecular Formula | C12H6F6N2O3 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 5-(benzimidazol-1-yl)-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(=O)n1cnc2ccccc21 |
| InChI | InChI=1S/C12H6F6N2O3/c13-10(14,12(17,18)11(15,16)9(22)23)8(21)20-5-19-6-3-1-2-4-7(6)20/h1-5H,(H,22,23) |
| InChIKey | HMXPDDKNJLKKLH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|