C12H12F3N3O — CID 156708262
N-(4,4,4-trifluorobutyl)benzimidazole-1-carboxamide (PubChem CID 156708262) has the molecular formula C12H12F3N3O and a molecular weight of 271.24 g/mol. Its IUPAC name is N-(4,4,4-trifluorobutyl)benzimidazole-1-carboxamide.
| Compound Name | N-(4,4,4-trifluorobutyl)benzimidazole-1-carboxamide |
|---|---|
| PubChem CID | 156708262 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N-(4,4,4-trifluorobutyl)benzimidazole-1-carboxamide |
| SMILES | O=C(NCCCC(F)(F)F)n1cnc2ccccc21 |
| InChI | InChI=1S/C12H12F3N3O/c13-12(14,15)6-3-7-16-11(19)18-8-17-9-4-1-2-5-10(9)18/h1-2,4-5,8H,3,6-7H2,(H,16,19) |
| InChIKey | WIBBJDQSCQWWPR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|