C19H10Cl2F4N2O3 — CID 86685527
5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxylic acid (PubChem CID 86685527) has the molecular formula C19H10Cl2F4N2O3 and a molecular weight of 461.20 g/mol. Its IUPAC name is 5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxylic acid.
| Compound Name | 5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxylic acid |
|---|---|
| PubChem CID | 86685527 |
| Molecular Formula | C19H10Cl2F4N2O3 |
| Molecular Weight | 461.20 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | 5-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]indolizine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc(C2=NOC(c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)C2)n2cccc12 |
| InChI | InChI=1S/C19H10Cl2F4N2O3/c20-11-6-9(7-12(21)16(11)22)18(19(23,24)25)8-13(26-30-18)15-4-3-10(17(28)29)14-2-1-5-27(14)15/h1-7H,8H2,(H,28,29) |
| InChIKey | NTOCSVQZZLNHGF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.20 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|