C15H26N2O4S — CID 86686860
tert-butyl (2S,4R)-4-ethenyl-4-(ethenylsulfonylamino)-2-methylpiperidine-1-carboxylate (PubChem CID 86686860) has the molecular formula C15H26N2O4S and a molecular weight of 330.45 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-ethenyl-4-(ethenylsulfonylamino)-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-ethenyl-4-(ethenylsulfonylamino)-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86686860 |
| Molecular Formula | C15H26N2O4S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | tert-butyl (2S,4R)-4-ethenyl-4-(ethenylsulfonylamino)-2-methylpiperidine-1-carboxylate |
| SMILES | C=C[C@@]1(NS(=O)(=O)C=C)CCN(C(=O)OC(C)(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/C15H26N2O4S/c1-7-15(16-22(19,20)8-2)9-10-17(12(3)11-15)13(18)21-14(4,5)6/h7-8,12,16H,1-2,9-11H2,3-6H3/t12-,15+/m0/s1 |
| InChIKey | WVCDXHYNMCJBDT-SWLSCSKDSA-N |
| XLogP | 2.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|