C28H22F6N4O4S — CID 86687370
N-pyrimidin-4-yl-5-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]naphthalene-2-sulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 86687370) has the molecular formula C28H22F6N4O4S and a molecular weight of 624.56 g/mol. Its IUPAC name is N-pyrimidin-4-yl-5-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]naphthalene-2-sulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-pyrimidin-4-yl-5-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]naphthalene-2-sulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86687370 |
| Molecular Formula | C28H22F6N4O4S |
| Molecular Weight | 624.56 g/mol |
| Exact Mass | 624.13 |
| IUPAC Name | N-pyrimidin-4-yl-5-[2-(1,2,3,6-tetrahydropyridin-4-yl)-4-(trifluoromethyl)phenyl]naphthalene-2-sulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=S(=O)(Nc1ccncn1)c1ccc2c(-c3ccc(C(F)(F)F)cc3C3=CCNCC3)cccc2c1 |
| InChI | InChI=1S/C26H21F3N4O2S.C2HF3O2/c27-26(28,29)19-4-6-23(24(15-19)17-8-11-30-12-9-17)22-3-1-2-18-14-20(5-7-21(18)22)36(34,35)33-25-10-13-31-16-32-25;3-2(4,5)1(6)7/h1-8,10,13-16,30H,9,11-12H2,(H,31,32,33);(H,6,7) |
| InChIKey | UJWAFFZIJTWICB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.56 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |