C20H15F3N4O3S — CID 155125595
(E)-N-pyrimidin-4-yl-3-[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]prop-2-enamide (PubChem CID 155125595) has the molecular formula C20H15F3N4O3S and a molecular weight of 448.43 g/mol. Its IUPAC name is (E)-N-pyrimidin-4-yl-3-[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]prop-2-enamide.
| Compound Name | (E)-N-pyrimidin-4-yl-3-[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155125595 |
| Molecular Formula | C20H15F3N4O3S |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | (E)-N-pyrimidin-4-yl-3-[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(NS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)Nc1ccncn1 |
| InChI | InChI=1S/C20H15F3N4O3S/c21-20(22,23)15-4-2-6-17(12-15)31(29,30)27-16-5-1-3-14(11-16)7-8-19(28)26-18-9-10-24-13-25-18/h1-13,27H,(H,24,25,26,28)/b8-7+ |
| InChIKey | BESXFKWOMRIMCA-BQYQJAHWSA-N |
| XLogP | 3.95 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|