C7H7Cl2NO2 — CID 86688707
methyl 2,5-dichloro-1-methylpyrrole-3-carboxylate (PubChem CID 86688707) has the molecular formula C7H7Cl2NO2 and a molecular weight of 208.04 g/mol. Its IUPAC name is methyl 2,5-dichloro-1-methylpyrrole-3-carboxylate.
| Compound Name | methyl 2,5-dichloro-1-methylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 86688707 |
| Molecular Formula | C7H7Cl2NO2 |
| Molecular Weight | 208.04 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | methyl 2,5-dichloro-1-methylpyrrole-3-carboxylate |
| SMILES | COC(=O)c1cc(Cl)n(C)c1Cl |
| InChI | InChI=1S/C7H7Cl2NO2/c1-10-5(8)3-4(6(10)9)7(11)12-2/h3H,1-2H3 |
| InChIKey | VWIYURGPCXTRRX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.04 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |