C25H28Cl2N4O5 — CID 86689088
1-[(4-chlorophenyl)methyl]-6-(3-chloro-4-propan-2-yloxyanilino)-3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-1,3,5-triazine-2,4-dione (PubChem CID 86689088) has the molecular formula C25H28Cl2N4O5 and a molecular weight of 535.43 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-6-(3-chloro-4-propan-2-yloxyanilino)-3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-6-(3-chloro-4-propan-2-yloxyanilino)-3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 86689088 |
| Molecular Formula | C25H28Cl2N4O5 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-6-(3-chloro-4-propan-2-yloxyanilino)-3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-1,3,5-triazine-2,4-dione |
| SMILES | CC(C)Oc1ccc(Nc2nc(=O)n(C[C@@H]3COC(C)(C)O3)c(=O)n2Cc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C25H28Cl2N4O5/c1-15(2)35-21-10-9-18(11-20(21)27)28-22-29-23(32)31(13-19-14-34-25(3,4)36-19)24(33)30(22)12-16-5-7-17(26)8-6-16/h5-11,15,19H,12-14H2,1-4H3,(H,28,29,32)/t19-/m1/s1 |
| InChIKey | GXKMZKGFCCOXPC-LJQANCHMSA-N |
| XLogP | 4.44 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |