C16H18N6O3 — CID 86691212
tert-butyl N-[3-(6-amino-8-oxo-7H-purin-9-yl)phenyl]carbamate (PubChem CID 86691212) has the molecular formula C16H18N6O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is tert-butyl N-[3-(6-amino-8-oxo-7H-purin-9-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[3-(6-amino-8-oxo-7H-purin-9-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 86691212 |
| Molecular Formula | C16H18N6O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | tert-butyl N-[3-(6-amino-8-oxo-7H-purin-9-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(-n2c(=O)[nH]c3c(N)ncnc32)c1 |
| InChI | InChI=1S/C16H18N6O3/c1-16(2,3)25-15(24)20-9-5-4-6-10(7-9)22-13-11(21-14(22)23)12(17)18-8-19-13/h4-8H,1-3H3,(H,20,24)(H,21,23)(H2,17,18,19) |
| InChIKey | FTOXRZRPGMYHJC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |