C9H7ClN2O4S2 — CID 86691256
N-(4-chloro-3-methyl-1,2-oxazol-5-yl)-2-formylthiophene-3-sulfonamide (PubChem CID 86691256) has the molecular formula C9H7ClN2O4S2 and a molecular weight of 306.75 g/mol. Its IUPAC name is N-(4-chloro-3-methyl-1,2-oxazol-5-yl)-2-formylthiophene-3-sulfonamide.
| Compound Name | N-(4-chloro-3-methyl-1,2-oxazol-5-yl)-2-formylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 86691256 |
| Molecular Formula | C9H7ClN2O4S2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | N-(4-chloro-3-methyl-1,2-oxazol-5-yl)-2-formylthiophene-3-sulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccsc2C=O)c1Cl |
| InChI | InChI=1S/C9H7ClN2O4S2/c1-5-8(10)9(16-11-5)12-18(14,15)7-2-3-17-6(7)4-13/h2-4,12H,1H3 |
| InChIKey | YQALWPNGBBVBRG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|