C16H16FN7O2 — CID 86692672
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitro-N-[(3R)-piperidin-3-yl]pyrimidin-4-amine (PubChem CID 86692672) has the molecular formula C16H16FN7O2 and a molecular weight of 357.35 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitro-N-[(3R)-piperidin-3-yl]pyrimidin-4-amine.
| Compound Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitro-N-[(3R)-piperidin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 86692672 |
| Molecular Formula | C16H16FN7O2 |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitro-N-[(3R)-piperidin-3-yl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cnc(-c2cnc3ccc(F)cn23)nc1N[C@@H]1CCCNC1 |
| InChI | InChI=1S/C16H16FN7O2/c17-10-3-4-14-19-7-12(23(14)9-10)15-20-8-13(24(25)26)16(22-15)21-11-2-1-5-18-6-11/h3-4,7-9,11,18H,1-2,5-6H2,(H,20,21,22)/t11-/m1/s1 |
| InChIKey | AQKRRICWFRKEBJ-LLVKDONJSA-N |
| XLogP | 2.00 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|