C20H17N3O2S — CID 86694389
N-[6-amino-2-(2-phenylethynyl)-3-pyridinyl]-N-methylbenzenesulfonamide (PubChem CID 86694389) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[6-amino-2-(2-phenylethynyl)-3-pyridinyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[6-amino-2-(2-phenylethynyl)-3-pyridinyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 86694389 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[6-amino-2-(2-phenylethynyl)-3-pyridinyl]-N-methylbenzenesulfonamide |
| SMILES | CN(c1ccc(N)nc1C#Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17N3O2S/c1-23(26(24,25)17-10-6-3-7-11-17)19-14-15-20(21)22-18(19)13-12-16-8-4-2-5-9-16/h2-11,14-15H,1H3,(H2,21,22) |
| InChIKey | WIFSEUWTZNRHSQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|