C22H22BrN3O4 — CID 86695560
2-[2-[4-(1-bromoethyl)-2-methylphenyl]-2-oxoethyl]-5-[(5-methoxy-2-pyridinyl)methoxy]pyridazin-3-one (PubChem CID 86695560) has the molecular formula C22H22BrN3O4 and a molecular weight of 472.34 g/mol. Its IUPAC name is 2-[2-[4-(1-bromoethyl)-2-methylphenyl]-2-oxoethyl]-5-[(5-methoxy-2-pyridinyl)methoxy]pyridazin-3-one.
| Compound Name | 2-[2-[4-(1-bromoethyl)-2-methylphenyl]-2-oxoethyl]-5-[(5-methoxy-2-pyridinyl)methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 86695560 |
| Molecular Formula | C22H22BrN3O4 |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 2-[2-[4-(1-bromoethyl)-2-methylphenyl]-2-oxoethyl]-5-[(5-methoxy-2-pyridinyl)methoxy]pyridazin-3-one |
| SMILES | COc1ccc(COc2cnn(CC(=O)c3ccc(C(C)Br)cc3C)c(=O)c2)nc1 |
| InChI | InChI=1S/C22H22BrN3O4/c1-14-8-16(15(2)23)4-7-20(14)21(27)12-26-22(28)9-19(11-25-26)30-13-17-5-6-18(29-3)10-24-17/h4-11,15H,12-13H2,1-3H3 |
| InChIKey | VLIXRVWQUQKXDE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|