C20H17BrClN3O3 — CID 174573607
2-[2-[4-(2-bromoethyl)phenyl]-2-oxoethyl]-5-[(5-chloro-2-pyridinyl)methoxy]pyridazin-3-one (PubChem CID 174573607) has the molecular formula C20H17BrClN3O3 and a molecular weight of 462.73 g/mol. Its IUPAC name is 2-[2-[4-(2-bromoethyl)phenyl]-2-oxoethyl]-5-[(5-chloro-2-pyridinyl)methoxy]pyridazin-3-one.
| Compound Name | 2-[2-[4-(2-bromoethyl)phenyl]-2-oxoethyl]-5-[(5-chloro-2-pyridinyl)methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 174573607 |
| Molecular Formula | C20H17BrClN3O3 |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | 2-[2-[4-(2-bromoethyl)phenyl]-2-oxoethyl]-5-[(5-chloro-2-pyridinyl)methoxy]pyridazin-3-one |
| SMILES | O=C(Cn1ncc(OCc2ccc(Cl)cn2)cc1=O)c1ccc(CCBr)cc1 |
| InChI | InChI=1S/C20H17BrClN3O3/c21-8-7-14-1-3-15(4-2-14)19(26)12-25-20(27)9-18(11-24-25)28-13-17-6-5-16(22)10-23-17/h1-6,9-11H,7-8,12-13H2 |
| InChIKey | AOWDSOXGEZVKOF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|