C20H17FN2O4 — CID 68892721
2-[2-[3-fluoro-4-(hydroxymethyl)phenyl]-2-oxoethyl]-5-phenylmethoxypyridazin-3-one (PubChem CID 68892721) has the molecular formula C20H17FN2O4 and a molecular weight of 368.36 g/mol. Its IUPAC name is 2-[2-[3-fluoro-4-(hydroxymethyl)phenyl]-2-oxoethyl]-5-phenylmethoxypyridazin-3-one.
| Compound Name | 2-[2-[3-fluoro-4-(hydroxymethyl)phenyl]-2-oxoethyl]-5-phenylmethoxypyridazin-3-one |
|---|---|
| PubChem CID | 68892721 |
| Molecular Formula | C20H17FN2O4 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-[2-[3-fluoro-4-(hydroxymethyl)phenyl]-2-oxoethyl]-5-phenylmethoxypyridazin-3-one |
| SMILES | O=C(Cn1ncc(OCc2ccccc2)cc1=O)c1ccc(CO)c(F)c1 |
| InChI | InChI=1S/C20H17FN2O4/c21-18-8-15(6-7-16(18)12-24)19(25)11-23-20(26)9-17(10-22-23)27-13-14-4-2-1-3-5-14/h1-10,24H,11-13H2 |
| InChIKey | GKCSAWDCMDKPBG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |