C22H20N6O2S — CID 86696984
12-[(4-methoxyphenyl)methyl]-4-[(4-methylpyrimidin-2-yl)amino]-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(13),2(6),3,10-tetraen-9-one (PubChem CID 86696984) has the molecular formula C22H20N6O2S and a molecular weight of 432.51 g/mol. Its IUPAC name is 12-[(4-methoxyphenyl)methyl]-4-[(4-methylpyrimidin-2-yl)amino]-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(13),2(6),3,10-tetraen-9-one.
| Compound Name | 12-[(4-methoxyphenyl)methyl]-4-[(4-methylpyrimidin-2-yl)amino]-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(13),2(6),3,10-tetraen-9-one |
|---|---|
| PubChem CID | 86696984 |
| Molecular Formula | C22H20N6O2S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 12-[(4-methoxyphenyl)methyl]-4-[(4-methylpyrimidin-2-yl)amino]-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(13),2(6),3,10-tetraen-9-one |
| SMILES | COc1ccc(Cn2cc3c(n2)C(=O)CCc2sc(Nc4nccc(C)n4)nc2-3)cc1 |
| InChI | InChI=1S/C22H20N6O2S/c1-13-9-10-23-21(24-13)26-22-25-20-16-12-28(11-14-3-5-15(30-2)6-4-14)27-19(16)17(29)7-8-18(20)31-22/h3-6,9-10,12H,7-8,11H2,1-2H3,(H,23,24,25,26) |
| InChIKey | QBDLDSHZIAXOLK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |