C18H21N7OS — CID 71666867
N-(4-methylpyrimidin-2-yl)-9-(oxan-4-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine (PubChem CID 71666867) has the molecular formula C18H21N7OS and a molecular weight of 383.48 g/mol. Its IUPAC name is N-(4-methylpyrimidin-2-yl)-9-(oxan-4-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine.
| Compound Name | N-(4-methylpyrimidin-2-yl)-9-(oxan-4-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
|---|---|
| PubChem CID | 71666867 |
| Molecular Formula | C18H21N7OS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-(4-methylpyrimidin-2-yl)-9-(oxan-4-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
| SMILES | Cc1ccnc(Nc2nc3c(s2)CCN(C2CCOCC2)c2[nH]ncc2-3)n1 |
| InChI | InChI=1S/C18H21N7OS/c1-11-2-6-19-17(21-11)23-18-22-15-13-10-20-24-16(13)25(7-3-14(15)27-18)12-4-8-26-9-5-12/h2,6,10,12H,3-5,7-9H2,1H3,(H,20,24)(H,19,21,22,23) |
| InChIKey | FYTLFCYNBOUIFH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |