C17H17F2N7OS — CID 71666575
9-(3,3-difluorocyclobutyl)-N-(4-methoxypyrimidin-2-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine (PubChem CID 71666575) has the molecular formula C17H17F2N7OS and a molecular weight of 405.43 g/mol. Its IUPAC name is 9-(3,3-difluorocyclobutyl)-N-(4-methoxypyrimidin-2-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine.
| Compound Name | 9-(3,3-difluorocyclobutyl)-N-(4-methoxypyrimidin-2-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
|---|---|
| PubChem CID | 71666575 |
| Molecular Formula | C17H17F2N7OS |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 9-(3,3-difluorocyclobutyl)-N-(4-methoxypyrimidin-2-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
| SMILES | COc1ccnc(Nc2nc3c(s2)CCN(C2CC(F)(F)C2)c2[nH]ncc2-3)n1 |
| InChI | InChI=1S/C17H17F2N7OS/c1-27-12-2-4-20-15(22-12)24-16-23-13-10-8-21-25-14(10)26(5-3-11(13)28-16)9-6-17(18,19)7-9/h2,4,8-9H,3,5-7H2,1H3,(H,21,25)(H,20,22,23,24) |
| InChIKey | LZHNFCZGMXSQNX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |