C16H17N7OS — CID 71666863
N-(4-methylpyrimidin-2-yl)-9-(oxetan-3-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine (PubChem CID 71666863) has the molecular formula C16H17N7OS and a molecular weight of 355.43 g/mol. Its IUPAC name is N-(4-methylpyrimidin-2-yl)-9-(oxetan-3-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine.
| Compound Name | N-(4-methylpyrimidin-2-yl)-9-(oxetan-3-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
|---|---|
| PubChem CID | 71666863 |
| Molecular Formula | C16H17N7OS |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-(4-methylpyrimidin-2-yl)-9-(oxetan-3-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
| SMILES | Cc1ccnc(Nc2nc3c(s2)CCN(C2COC2)c2[nH]ncc2-3)n1 |
| InChI | InChI=1S/C16H17N7OS/c1-9-2-4-17-15(19-9)21-16-20-13-11-6-18-22-14(11)23(10-7-24-8-10)5-3-12(13)25-16/h2,4,6,10H,3,5,7-8H2,1H3,(H,18,22)(H,17,19,20,21) |
| InChIKey | PMSMFZHNEJGJPC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |