C14H14N6OS — CID 56597579
(9R)-9-methyl-N-(4-methylpyrimidin-2-yl)-8-oxa-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine (PubChem CID 56597579) has the molecular formula C14H14N6OS and a molecular weight of 314.37 g/mol. Its IUPAC name is (9R)-9-methyl-N-(4-methylpyrimidin-2-yl)-8-oxa-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine.
| Compound Name | (9R)-9-methyl-N-(4-methylpyrimidin-2-yl)-8-oxa-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
|---|---|
| PubChem CID | 56597579 |
| Molecular Formula | C14H14N6OS |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (9R)-9-methyl-N-(4-methylpyrimidin-2-yl)-8-oxa-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
| SMILES | Cc1ccnc(Nc2nc3c(s2)CO[C@H](C)c2[nH]ncc2-3)n1 |
| InChI | InChI=1S/C14H14N6OS/c1-7-3-4-15-13(17-7)19-14-18-12-9-5-16-20-11(9)8(2)21-6-10(12)22-14/h3-5,8H,6H2,1-2H3,(H,16,20)(H,15,17,18,19)/t8-/m1/s1 |
| InChIKey | ZRGTTZBYTNKXGI-MRVPVSSYSA-N |
| XLogP | 2.97 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |