C14H13FN6OS — CID 56643661
9-ethyl-N-(5-fluoropyrimidin-2-yl)-8-oxa-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine (PubChem CID 56643661) has the molecular formula C14H13FN6OS and a molecular weight of 332.36 g/mol. Its IUPAC name is 9-ethyl-N-(5-fluoropyrimidin-2-yl)-8-oxa-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine.
| Compound Name | 9-ethyl-N-(5-fluoropyrimidin-2-yl)-8-oxa-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
|---|---|
| PubChem CID | 56643661 |
| Molecular Formula | C14H13FN6OS |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 9-ethyl-N-(5-fluoropyrimidin-2-yl)-8-oxa-5-thia-3,11,12-triazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
| SMILES | CCC1OCc2sc(Nc3ncc(F)cn3)nc2-c2cn[nH]c21 |
| InChI | InChI=1S/C14H13FN6OS/c1-2-9-11-8(5-18-21-11)12-10(6-22-9)23-14(19-12)20-13-16-3-7(15)4-17-13/h3-5,9H,2,6H2,1H3,(H,18,21)(H,16,17,19,20) |
| InChIKey | KIAZMENSKYADMV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |