C18H15FN8S — CID 56602969
N-(5-fluoropyrimidin-2-yl)-9-(pyridin-2-ylmethyl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine (PubChem CID 56602969) has the molecular formula C18H15FN8S and a molecular weight of 394.44 g/mol. Its IUPAC name is N-(5-fluoropyrimidin-2-yl)-9-(pyridin-2-ylmethyl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine.
| Compound Name | N-(5-fluoropyrimidin-2-yl)-9-(pyridin-2-ylmethyl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
|---|---|
| PubChem CID | 56602969 |
| Molecular Formula | C18H15FN8S |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-(5-fluoropyrimidin-2-yl)-9-(pyridin-2-ylmethyl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
| SMILES | Fc1cnc(Nc2nc3c(s2)CCN(Cc2ccccn2)c2[nH]ncc2-3)nc1 |
| InChI | InChI=1S/C18H15FN8S/c19-11-7-21-17(22-8-11)25-18-24-15-13-9-23-26-16(13)27(6-4-14(15)28-18)10-12-3-1-2-5-20-12/h1-3,5,7-9H,4,6,10H2,(H,23,26)(H,21,22,24,25) |
| InChIKey | DSWKPHRKLLQZFV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |