C20H25N7OS — CID 160651808
N,11-dimethyl-9-[(5-morpholin-4-yl-2-pyridinyl)methyl]-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine (PubChem CID 160651808) has the molecular formula C20H25N7OS and a molecular weight of 411.54 g/mol. Its IUPAC name is N,11-dimethyl-9-[(5-morpholin-4-yl-2-pyridinyl)methyl]-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine.
| Compound Name | N,11-dimethyl-9-[(5-morpholin-4-yl-2-pyridinyl)methyl]-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
|---|---|
| PubChem CID | 160651808 |
| Molecular Formula | C20H25N7OS |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N,11-dimethyl-9-[(5-morpholin-4-yl-2-pyridinyl)methyl]-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
| SMILES | CNc1nc2c(s1)CCN(Cc1ccc(N3CCOCC3)cn1)c1c-2cnn1C |
| InChI | InChI=1S/C20H25N7OS/c1-21-20-24-18-16-12-23-25(2)19(16)27(6-5-17(18)29-20)13-14-3-4-15(11-22-14)26-7-9-28-10-8-26/h3-4,11-12H,5-10,13H2,1-2H3,(H,21,24) |
| InChIKey | SVRAUULYCVWFSS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |