C14H14FN7S — CID 56603036
9-ethyl-N-(5-fluoropyrimidin-2-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine (PubChem CID 56603036) has the molecular formula C14H14FN7S and a molecular weight of 331.38 g/mol. Its IUPAC name is 9-ethyl-N-(5-fluoropyrimidin-2-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine.
| Compound Name | 9-ethyl-N-(5-fluoropyrimidin-2-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
|---|---|
| PubChem CID | 56603036 |
| Molecular Formula | C14H14FN7S |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 9-ethyl-N-(5-fluoropyrimidin-2-yl)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-4-amine |
| SMILES | CCN1CCc2sc(Nc3ncc(F)cn3)nc2-c2cn[nH]c21 |
| InChI | InChI=1S/C14H14FN7S/c1-2-22-4-3-10-11(9-7-18-21-12(9)22)19-14(23-10)20-13-16-5-8(15)6-17-13/h5-7H,2-4H2,1H3,(H,18,21)(H,16,17,19,20) |
| InChIKey | VNUHUQPGXWCGPH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |