C11H15N5OS — CID 158553470
2-[4-(methylamino)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-9-yl]ethanol (PubChem CID 158553470) has the molecular formula C11H15N5OS and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-[4-(methylamino)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-9-yl]ethanol.
| Compound Name | 2-[4-(methylamino)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-9-yl]ethanol |
|---|---|
| PubChem CID | 158553470 |
| Molecular Formula | C11H15N5OS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-[4-(methylamino)-5-thia-3,9,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraen-9-yl]ethanol |
| SMILES | CNc1nc2c(s1)CCN(CCO)c1[nH]ncc1-2 |
| InChI | InChI=1S/C11H15N5OS/c1-12-11-14-9-7-6-13-15-10(7)16(4-5-17)3-2-8(9)18-11/h6,17H,2-5H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | MSRIOHZEFONTTQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |