C20H30BN5O4 — CID 86697442
propan-2-yl 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidin-5-yl]piperazine-1-carboxylate (PubChem CID 86697442) has the molecular formula C20H30BN5O4 and a molecular weight of 415.30 g/mol. Its IUPAC name is propan-2-yl 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidin-5-yl]piperazine-1-carboxylate.
| Compound Name | propan-2-yl 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidin-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86697442 |
| Molecular Formula | C20H30BN5O4 |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | propan-2-yl 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidin-5-yl]piperazine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCN(c2ccn3ncc(B4OC(C)(C)C(C)(C)O4)c3n2)CC1 |
| InChI | InChI=1S/C20H30BN5O4/c1-14(2)28-18(27)25-11-9-24(10-12-25)16-7-8-26-17(23-16)15(13-22-26)21-29-19(3,4)20(5,6)30-21/h7-8,13-14H,9-12H2,1-6H3 |
| InChIKey | NGLZNVQTZWUXTB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|