C17H15BrN6O4 — CID 86697451
(4-nitrophenyl) 4-(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)piperazine-1-carboxylate (PubChem CID 86697451) has the molecular formula C17H15BrN6O4 and a molecular weight of 447.25 g/mol. Its IUPAC name is (4-nitrophenyl) 4-(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)piperazine-1-carboxylate.
| Compound Name | (4-nitrophenyl) 4-(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86697451 |
| Molecular Formula | C17H15BrN6O4 |
| Molecular Weight | 447.25 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | (4-nitrophenyl) 4-(3-bromopyrazolo[1,5-a]pyrimidin-5-yl)piperazine-1-carboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)N1CCN(c2ccn3ncc(Br)c3n2)CC1 |
| InChI | InChI=1S/C17H15BrN6O4/c18-14-11-19-23-6-5-15(20-16(14)23)21-7-9-22(10-8-21)17(25)28-13-3-1-12(2-4-13)24(26)27/h1-6,11H,7-10H2 |
| InChIKey | SYPMKGOUMIPKJC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 106.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|