C19H17ClN4O4S — CID 2796146
(4-nitrophenyl) 4-(6-chloro-1,3-benzothiazol-2-yl)-1,4-diazepane-1-carboxylate (PubChem CID 2796146) has the molecular formula C19H17ClN4O4S and a molecular weight of 432.89 g/mol. Its IUPAC name is (4-nitrophenyl) 4-(6-chloro-1,3-benzothiazol-2-yl)-1,4-diazepane-1-carboxylate.
| Compound Name | (4-nitrophenyl) 4-(6-chloro-1,3-benzothiazol-2-yl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 2796146 |
| Molecular Formula | C19H17ClN4O4S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (4-nitrophenyl) 4-(6-chloro-1,3-benzothiazol-2-yl)-1,4-diazepane-1-carboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)N1CCCN(c2nc3ccc(Cl)cc3s2)CC1 |
| InChI | InChI=1S/C19H17ClN4O4S/c20-13-2-7-16-17(12-13)29-18(21-16)22-8-1-9-23(11-10-22)19(25)28-15-5-3-14(4-6-15)24(26)27/h2-7,12H,1,8-11H2 |
| InChIKey | IGUGALJSDNAUSV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|