C29H38F3N3O4Si — CID 86698169
methyl 2-ethyl-2-[[4-[5-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]methyl]butanoate (PubChem CID 86698169) has the molecular formula C29H38F3N3O4Si and a molecular weight of 577.72 g/mol. Its IUPAC name is methyl 2-ethyl-2-[[4-[5-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]methyl]butanoate.
| Compound Name | methyl 2-ethyl-2-[[4-[5-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]methyl]butanoate |
|---|---|
| PubChem CID | 86698169 |
| Molecular Formula | C29H38F3N3O4Si |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | methyl 2-ethyl-2-[[4-[5-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]methyl]butanoate |
| SMILES | CCC(CC)(COc1ccc(-c2ccc(-c3nc(C(F)(F)F)cn3COCC[Si](C)(C)C)cn2)cc1)C(=O)OC |
| InChI | InChI=1S/C29H38F3N3O4Si/c1-7-28(8-2,27(36)37-3)19-39-23-12-9-21(10-13-23)24-14-11-22(17-33-24)26-34-25(29(30,31)32)18-35(26)20-38-15-16-40(4,5)6/h9-14,17-18H,7-8,15-16,19-20H2,1-6H3 |
| InChIKey | HVMQTDCWHWSOKL-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|