C10H9ClFN5O — CID 86701885
5-amino-3-(3-chloro-4-fluoroanilino)-1H-pyrazole-4-carboxamide (PubChem CID 86701885) has the molecular formula C10H9ClFN5O and a molecular weight of 269.67 g/mol. Its IUPAC name is 5-amino-3-(3-chloro-4-fluoroanilino)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-(3-chloro-4-fluoroanilino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86701885 |
| Molecular Formula | C10H9ClFN5O |
| Molecular Weight | 269.67 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 5-amino-3-(3-chloro-4-fluoroanilino)-1H-pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(Nc2ccc(F)c(Cl)c2)n[nH]c1N |
| InChI | InChI=1S/C10H9ClFN5O/c11-5-3-4(1-2-6(5)12)15-10-7(9(14)18)8(13)16-17-10/h1-3H,(H2,14,18)(H4,13,15,16,17) |
| InChIKey | KSSBVLJBNPHQTI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.67 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |