C19H21N5O — CID 86701998
N-(imidazo[1,2-a]pyrazin-6-ylmethyl)-4-piperidin-4-ylbenzamide (PubChem CID 86701998) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyrazin-6-ylmethyl)-4-piperidin-4-ylbenzamide.
| Compound Name | N-(imidazo[1,2-a]pyrazin-6-ylmethyl)-4-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 86701998 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-(imidazo[1,2-a]pyrazin-6-ylmethyl)-4-piperidin-4-ylbenzamide |
| SMILES | O=C(NCc1cn2ccnc2cn1)c1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C19H21N5O/c25-19(23-11-17-13-24-10-9-21-18(24)12-22-17)16-3-1-14(2-4-16)15-5-7-20-8-6-15/h1-4,9-10,12-13,15,20H,5-8,11H2,(H,23,25) |
| InChIKey | ZZANSPGIWRDWCS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |