C23H18N4O2S — CID 86703292
3-[6-[(6-methoxy-2-phenyl-1H-indol-3-yl)methyl]-2-pyridinyl]-2H-1,2,4-oxadiazole-5-thione (PubChem CID 86703292) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is 3-[6-[(6-methoxy-2-phenyl-1H-indol-3-yl)methyl]-2-pyridinyl]-2H-1,2,4-oxadiazole-5-thione.
| Compound Name | 3-[6-[(6-methoxy-2-phenyl-1H-indol-3-yl)methyl]-2-pyridinyl]-2H-1,2,4-oxadiazole-5-thione |
|---|---|
| PubChem CID | 86703292 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 3-[6-[(6-methoxy-2-phenyl-1H-indol-3-yl)methyl]-2-pyridinyl]-2H-1,2,4-oxadiazole-5-thione |
| SMILES | COc1ccc2c(Cc3cccc(-c4nc(=S)o[nH]4)n3)c(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C23H18N4O2S/c1-28-16-10-11-17-18(21(25-20(17)13-16)14-6-3-2-4-7-14)12-15-8-5-9-19(24-15)22-26-23(30)29-27-22/h2-11,13,25H,12H2,1H3,(H,26,27,30) |
| InChIKey | VFRJTCXLQXHWBO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|