C17H15NO2 — CID 86703337
N-(1-methyl-3-oxo-1,2-dihydroinden-5-yl)benzamide (PubChem CID 86703337) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-(1-methyl-3-oxo-1,2-dihydroinden-5-yl)benzamide.
| Compound Name | N-(1-methyl-3-oxo-1,2-dihydroinden-5-yl)benzamide |
|---|---|
| PubChem CID | 86703337 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-(1-methyl-3-oxo-1,2-dihydroinden-5-yl)benzamide |
| SMILES | CC1CC(=O)c2cc(NC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C17H15NO2/c1-11-9-16(19)15-10-13(7-8-14(11)15)18-17(20)12-5-3-2-4-6-12/h2-8,10-11H,9H2,1H3,(H,18,20) |
| InChIKey | BYVRXJPJWIELRQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |