C34H31ClN2O4 — CID 162097378
6-amino-3-methyl-2,3-dihydroinden-1-one;benzoyl chloride;N-(1-methyl-3-oxo-1,2-dihydroinden-5-yl)benzamide (PubChem CID 162097378) has the molecular formula C34H31ClN2O4 and a molecular weight of 567.09 g/mol. Its IUPAC name is 6-amino-3-methyl-2,3-dihydroinden-1-one;benzoyl chloride;N-(1-methyl-3-oxo-1,2-dihydroinden-5-yl)benzamide.
| Compound Name | 6-amino-3-methyl-2,3-dihydroinden-1-one;benzoyl chloride;N-(1-methyl-3-oxo-1,2-dihydroinden-5-yl)benzamide |
|---|---|
| PubChem CID | 162097378 |
| Molecular Formula | C34H31ClN2O4 |
| Molecular Weight | 567.09 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 6-amino-3-methyl-2,3-dihydroinden-1-one;benzoyl chloride;N-(1-methyl-3-oxo-1,2-dihydroinden-5-yl)benzamide |
| SMILES | CC1CC(=O)c2cc(N)ccc21.CC1CC(=O)c2cc(NC(=O)c3ccccc3)ccc21.O=C(Cl)c1ccccc1 |
| InChI | InChI=1S/C17H15NO2.C10H11NO.C7H5ClO/c1-11-9-16(19)15-10-13(7-8-14(11)15)18-17(20)12-5-3-2-4-6-12;1-6-4-10(12)9-5-7(11)2-3-8(6)9;8-7(9)6-4-2-1-3-5-6/h2-8,10-11H,9H2,1H3,(H,18,20);2-3,5-6H,4,11H2,1H3;1-5H |
| InChIKey | ZEKTZPHEHHBRQK-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.09 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|