C17H19BrN2OSi — CID 86704676
(3-bromo-6-methoxy-2-phenylpyrazolo[1,5-a]pyridin-7-yl)-trimethylsilane (PubChem CID 86704676) has the molecular formula C17H19BrN2OSi and a molecular weight of 375.34 g/mol. Its IUPAC name is (3-bromo-6-methoxy-2-phenylpyrazolo[1,5-a]pyridin-7-yl)-trimethylsilane.
| Compound Name | (3-bromo-6-methoxy-2-phenylpyrazolo[1,5-a]pyridin-7-yl)-trimethylsilane |
|---|---|
| PubChem CID | 86704676 |
| Molecular Formula | C17H19BrN2OSi |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | (3-bromo-6-methoxy-2-phenylpyrazolo[1,5-a]pyridin-7-yl)-trimethylsilane |
| SMILES | COc1ccc2c(Br)c(-c3ccccc3)nn2c1[Si](C)(C)C |
| InChI | InChI=1S/C17H19BrN2OSi/c1-21-14-11-10-13-15(18)16(12-8-6-5-7-9-12)19-20(13)17(14)22(2,3)4/h5-11H,1-4H3 |
| InChIKey | PJNFDLKLJCSQPT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|