C30H30ClN3O3SSi — CID 86704808
(6-chloro-2-phenyl-7-trimethylsilylpyrazolo[1,5-a]pyridin-3-yl)-[6-[2-(methoxymethoxy)phenyl]sulfanyl-2-pyridinyl]methanol (PubChem CID 86704808) has the molecular formula C30H30ClN3O3SSi and a molecular weight of 576.19 g/mol. Its IUPAC name is (6-chloro-2-phenyl-7-trimethylsilylpyrazolo[1,5-a]pyridin-3-yl)-[6-[2-(methoxymethoxy)phenyl]sulfanyl-2-pyridinyl]methanol.
| Compound Name | (6-chloro-2-phenyl-7-trimethylsilylpyrazolo[1,5-a]pyridin-3-yl)-[6-[2-(methoxymethoxy)phenyl]sulfanyl-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 86704808 |
| Molecular Formula | C30H30ClN3O3SSi |
| Molecular Weight | 576.19 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | (6-chloro-2-phenyl-7-trimethylsilylpyrazolo[1,5-a]pyridin-3-yl)-[6-[2-(methoxymethoxy)phenyl]sulfanyl-2-pyridinyl]methanol |
| SMILES | COCOc1ccccc1Sc1cccc(C(O)c2c(-c3ccccc3)nn3c([Si](C)(C)C)c(Cl)ccc23)n1 |
| InChI | InChI=1S/C30H30ClN3O3SSi/c1-36-19-37-24-14-8-9-15-25(24)38-26-16-10-13-22(32-26)29(35)27-23-18-17-21(31)30(39(2,3)4)34(23)33-28(27)20-11-6-5-7-12-20/h5-18,29,35H,19H2,1-4H3 |
| InChIKey | PPVFLBLTMBCGSP-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.19 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|