C16H12ClF2N3O2 — CID 86705631
1-(4-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)-N-(2,6-difluoro-3,5-dimethoxyphenyl)methanimine (PubChem CID 86705631) has the molecular formula C16H12ClF2N3O2 and a molecular weight of 351.74 g/mol. Its IUPAC name is 1-(4-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)-N-(2,6-difluoro-3,5-dimethoxyphenyl)methanimine.
| Compound Name | 1-(4-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)-N-(2,6-difluoro-3,5-dimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 86705631 |
| Molecular Formula | C16H12ClF2N3O2 |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 1-(4-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)-N-(2,6-difluoro-3,5-dimethoxyphenyl)methanimine |
| SMILES | COc1cc(OC)c(F)c(/N=C/c2cnc3[nH]ccc3c2Cl)c1F |
| InChI | InChI=1S/C16H12ClF2N3O2/c1-23-10-5-11(24-2)14(19)15(13(10)18)21-6-8-7-22-16-9(12(8)17)3-4-20-16/h3-7H,1-2H3,(H,20,22)/b21-6+ |
| InChIKey | ISYJWIFAKQNLPK-AERZKKPOSA-N |
| XLogP | 4.26 |
| TPSA | 59.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|