C18H23N7O2 — CID 86705744
7-[(3aS,4R,6R,6aR)-6-(azidomethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-N-cyclopropylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 86705744) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 7-[(3aS,4R,6R,6aR)-6-(azidomethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-N-cyclopropylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(3aS,4R,6R,6aR)-6-(azidomethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-N-cyclopropylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 86705744 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 7-[(3aS,4R,6R,6aR)-6-(azidomethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-N-cyclopropylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H](CN=[N+]=[N-])C[C@@H](n3ccc4c(NC5CC5)ncnc43)[C@@H]2O1 |
| InChI | InChI=1S/C18H23N7O2/c1-18(2)26-14-10(8-22-24-19)7-13(15(14)27-18)25-6-5-12-16(23-11-3-4-11)20-9-21-17(12)25/h5-6,9-11,13-15H,3-4,7-8H2,1-2H3,(H,20,21,23)/t10-,13-,14-,15+/m1/s1 |
| InChIKey | IQMDAPSVQNQIRH-QZKOUSHUSA-N |
| XLogP | 3.40 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|