C24H22O3 — CID 86709347
2-(3,4-dihydro-2H-chromen-6-yl)-3-methyl-4-phenylmethoxybenzaldehyde (PubChem CID 86709347) has the molecular formula C24H22O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-6-yl)-3-methyl-4-phenylmethoxybenzaldehyde.
| Compound Name | 2-(3,4-dihydro-2H-chromen-6-yl)-3-methyl-4-phenylmethoxybenzaldehyde |
|---|---|
| PubChem CID | 86709347 |
| Molecular Formula | C24H22O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-6-yl)-3-methyl-4-phenylmethoxybenzaldehyde |
| SMILES | Cc1c(OCc2ccccc2)ccc(C=O)c1-c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C24H22O3/c1-17-22(27-16-18-6-3-2-4-7-18)11-10-21(15-25)24(17)20-9-12-23-19(14-20)8-5-13-26-23/h2-4,6-7,9-12,14-15H,5,8,13,16H2,1H3 |
| InChIKey | PVZPQICRVLFRIN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|