C25H19NO3S2 — CID 143505158
(5E)-5-[[5-(2,3-dihydro-1-benzofuran-5-yl)-2-phenylmethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 143505158) has the molecular formula C25H19NO3S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is (5E)-5-[[5-(2,3-dihydro-1-benzofuran-5-yl)-2-phenylmethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[5-(2,3-dihydro-1-benzofuran-5-yl)-2-phenylmethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143505158 |
| Molecular Formula | C25H19NO3S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | (5E)-5-[[5-(2,3-dihydro-1-benzofuran-5-yl)-2-phenylmethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C/c1cc(-c2ccc3c(c2)CCO3)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H19NO3S2/c27-24-23(31-25(30)26-24)14-20-13-18(17-6-8-21-19(12-17)10-11-28-21)7-9-22(20)29-15-16-4-2-1-3-5-16/h1-9,12-14H,10-11,15H2,(H,26,27,30)/b23-14+ |
| InChIKey | SMOPYGQFRRDZGF-OEAKJJBVSA-N |
| XLogP | 5.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|