C24H17F2NO3S2 — CID 58642863
(5Z)-5-[[5-(3,4-difluorophenyl)-3-methoxy-2-phenylmethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 58642863) has the molecular formula C24H17F2NO3S2 and a molecular weight of 469.53 g/mol. Its IUPAC name is (5Z)-5-[[5-(3,4-difluorophenyl)-3-methoxy-2-phenylmethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(3,4-difluorophenyl)-3-methoxy-2-phenylmethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58642863 |
| Molecular Formula | C24H17F2NO3S2 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | (5Z)-5-[[5-(3,4-difluorophenyl)-3-methoxy-2-phenylmethoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(-c2ccc(F)c(F)c2)cc(/C=C2\SC(=S)NC2=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H17F2NO3S2/c1-29-20-11-16(15-7-8-18(25)19(26)10-15)9-17(12-21-23(28)27-24(31)32-21)22(20)30-13-14-5-3-2-4-6-14/h2-12H,13H2,1H3,(H,27,28,31)/b21-12- |
| InChIKey | QRUSYBVRSHMOQT-MTJSOVHGSA-N |
| XLogP | 5.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|